CAS 71350-68-0 is the registry number for 2-Amino-1-(4-phenylphenyl)ethan-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-amino-1-(4-phenylphenyl)ethanone;hydrochloride (CAS 71350-68-0) is a chemical compound with the molecular formula C14H14ClNO and a molecular weight of 247.72 g/mol. IUPAC name: 2-amino-1-(4-phenylphenyl)ethanone;hydrochloride. InChIKey: OCCLXUJJCNIJSN-UHFFFAOYSA-N.
| Molecular formula | C14H14ClNO |
|---|---|
| Molecular weight | 247.72 g/mol |
| IUPAC name | 2-amino-1-(4-phenylphenyl)ethanone;hydrochloride |
| InChIKey | OCCLXUJJCNIJSN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)CN.Cl |
Computed by PubChem (NCBI)