Products 71601-13-3
CAS 71601-13-3 is the registry number for 3'-Methoxy-α-napthoflavone. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
2-(3-methoxyphenyl)benzo[h]chromen-4-one (CAS 71601-13-3) is a chemical compound with the molecular formula C20H14O3 and a molecular weight of 302.3 g/mol. IUPAC name: 2-(3-methoxyphenyl)benzo[h]chromen-4-one. InChIKey: PGRWDFOTLBQRCE-UHFFFAOYSA-N.
| Molecular formula | C20H14O3 |
|---|---|
| Molecular weight | 302.3 g/mol |
| IUPAC name | 2-(3-methoxyphenyl)benzo[h]chromen-4-one |
| InChIKey | PGRWDFOTLBQRCE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=CC(=O)C3=C(O2)C4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)