CAS 71740-76-6 appears in our catalog under these names: Boc-3-Amino-adamantane-1-carboxylic acid, 3-((tert-Butoxycarbonyl)amino)adamantane-1-carboxylic acid, 98%, 98%, 3-((tert-Butoxycarbonyl)amino)adamantane-1-carboxylic acid, 98%. Offered by: Iris Biotech, Chemat, Ambeed. Available pack sizes: 1g, 5g, 100mg, 250mg.
3-[(2-methylpropan-2-yl)oxycarbonylamino]adamantane-1-carboxylic acid (CAS 71740-76-6) is a chemical compound with the molecular formula C16H25NO4 and a molecular weight of 295.37 g/mol. IUPAC name: 3-[(2-methylpropan-2-yl)oxycarbonylamino]adamantane-1-carboxylic acid. InChIKey: UQFIEGHBAUBUKC-UHFFFAOYSA-N.
| Molecular formula | C16H25NO4 |
|---|---|
| Molecular weight | 295.37 g/mol |
| IUPAC name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]adamantane-1-carboxylic acid |
| InChIKey | UQFIEGHBAUBUKC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC12CC3CC(C1)CC(C3)(C2)C(=O)O |
Computed by PubChem (NCBI)