CAS 717880-97-2 is the registry number for Bis(2-methyl-5-nitrophenyl)methanone. Offered by: TRC. Available pack sizes: 2,5g.
Bis(2-methyl-5-nitrophenyl)methanone (CAS 717880-97-2) is a chemical compound with the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. IUPAC name: bis(2-methyl-5-nitrophenyl)methanone. InChIKey: LTECHUTXUHAREY-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O5 |
|---|---|
| Molecular weight | 300.27 g/mol |
| IUPAC name | bis(2-methyl-5-nitrophenyl)methanone |
| InChIKey | LTECHUTXUHAREY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)C2=C(C=CC(=C2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)