CAS 315673-29-1 is the registry number for 2-((2-Methyl-3-nitrophenyl)carbamoyl)benzoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(2-methyl-3-nitrophenyl)carbamoyl]benzoic acid (CAS 315673-29-1) is a chemical compound with the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. IUPAC name: 2-[(2-methyl-3-nitrophenyl)carbamoyl]benzoic acid. InChIKey: UEAPULVBSRZXTA-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O5 |
|---|---|
| Molecular weight | 300.27 g/mol |
| IUPAC name | 2-[(2-methyl-3-nitrophenyl)carbamoyl]benzoic acid |
| InChIKey | UEAPULVBSRZXTA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1[N+](=O)[O-])NC(=O)C2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)