CAS 52033-70-2 appears in our catalog under these names: 2-Nitro-5-(2-phenylacetamido)benzoic acid 98%, Benzoic acid, 2-nitro-5-[(2-phenylacetyl)amino]-, 98%, 98%, 2-Nitro-5-(phenylacetylamino)-benzoic acid, 95%, 2-Nitro-5-[(phenylacetyl)amino]benzoic Acid, 98%. Offered by: Ambeed, Chemat, Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-nitro-5-[(2-phenylacetyl)amino]benzoic acid (CAS 52033-70-2) is a chemical compound with the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. IUPAC name: 2-nitro-5-[(2-phenylacetyl)amino]benzoic acid. InChIKey: QHVQEQRGDKOHHC-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O5 |
|---|---|
| Molecular weight | 300.27 g/mol |
| IUPAC name | 2-nitro-5-[(2-phenylacetyl)amino]benzoic acid |
| InChIKey | QHVQEQRGDKOHHC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(=O)NC2=CC(=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)