Products 314284-99-6

CAS 314284-99-6 is the registry number for 2-(2-(4-Hydroxybenzoyl)hydrazinecarbonyl)benzoic acid, 90%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[[(4-hydroxybenzoyl)amino]carbamoyl]benzoic acid (CAS 314284-99-6) is a chemical compound with the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. IUPAC name: 2-[[(4-hydroxybenzoyl)amino]carbamoyl]benzoic acid. InChIKey: NDVVRHYEGGZEKX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H12N2O5
Molecular weight300.27 g/mol
IUPAC name2-[[(4-hydroxybenzoyl)amino]carbamoyl]benzoic acid
InChIKeyNDVVRHYEGGZEKX-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)NNC(=O)C2=CC=C(C=C2)O)C(=O)O

Computed by PubChem (NCBI)