CAS 97174-59-9 appears in our catalog under these names: 1,3-Bis(benzo[d][1,3]dioxol-4-yl)urea, 97%, 1,3-Bis(benzo(d)(1,3)dioxol-4-yl)urea, 97%, 1,3-Bis(benzo[d][1,3]dioxol-4-yl)urea, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg.
1,3-bis(1,3-benzodioxol-4-yl)urea (CAS 97174-59-9) is a chemical compound with the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. IUPAC name: 1,3-bis(1,3-benzodioxol-4-yl)urea. InChIKey: YHPOGLVHCGSZFI-UHFFFAOYSA-N.
| Molecular formula | C15H12N2O5 |
|---|---|
| Molecular weight | 300.27 g/mol |
| IUPAC name | 1,3-bis(1,3-benzodioxol-4-yl)urea |
| InChIKey | YHPOGLVHCGSZFI-UHFFFAOYSA-N |
| SMILES | C1OC2=CC=CC(=C2O1)NC(=O)NC3=C4C(=CC=C3)OCO4 |
Computed by PubChem (NCBI)