CAS 718603-58-8 is the registry number for Methyl 4-(1h-indol-3-yl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 4-(1H-indol-3-yl)-2,4-dioxobutanoate (CAS 718603-58-8) is a chemical compound with the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. IUPAC name: methyl 4-(1H-indol-3-yl)-2,4-dioxobutanoate. InChIKey: JZRSMIJNQIYQJJ-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | methyl 4-(1H-indol-3-yl)-2,4-dioxobutanoate |
| InChIKey | JZRSMIJNQIYQJJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CNC2=CC=CC=C21 |
Computed by PubChem (NCBI)