Products 7195-44-0
CAS 7195-44-0 appears in our catalog under these names: Diglycidyl terephthalate, 95%, bis(Oxiran-2-ylmethyl) terephthalate, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
Bis(oxiran-2-ylmethyl) benzene-1,4-dicarboxylate (CAS 7195-44-0) is a chemical compound with the molecular formula C14H14O6 and a molecular weight of 278.26 g/mol. IUPAC name: bis(oxiran-2-ylmethyl) benzene-1,4-dicarboxylate. InChIKey: NEPKLUNSRVEBIX-UHFFFAOYSA-N.
| Molecular formula | C14H14O6 |
|---|---|
| Molecular weight | 278.26 g/mol |
| IUPAC name | bis(oxiran-2-ylmethyl) benzene-1,4-dicarboxylate |
| InChIKey | NEPKLUNSRVEBIX-UHFFFAOYSA-N |
| SMILES | C1C(O1)COC(=O)C2=CC=C(C=C2)C(=O)OCC3CO3 |
Computed by PubChem (NCBI)
Synonyms:
Diglycidyl terephthalate, Terephthalic acid diglycidyl ester, Bis(2,3-epoxypropyl) terephthalate, Bis(oxiran-2-ylmethyl) terephthalate, bis(oxiran-2-ylmethyl) benzene-1,4-dicarboxylate, 1,4-Benzenedicarboxylic acid, bis(oxiranylmethyl) ester, 1,4-bis[(oxiran-2-yl)methyl] benzene-1,4-dicarboxylate, Telephthalic acid diglycidyl, Terephthalic acid bisglycidyl ester, Terephthalic acid bis[(oxiranyl)methyl] ester