CAS 71959-71-2 is the registry number for L-Tryptophan Isopropyl Ester Hydrochloride. Offered by: Mikromol. Available pack sizes: 25mg, 100mg.
Propan-2-yl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride (CAS 71959-71-2) is a chemical compound with the molecular formula C14H19ClN2O2 and a molecular weight of 282.76 g/mol. IUPAC name: propan-2-yl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride. InChIKey: NLQCNZIZRSOJNB-YDALLXLXSA-N.
| Molecular formula | C14H19ClN2O2 |
|---|---|
| Molecular weight | 282.76 g/mol |
| IUPAC name | propan-2-yl (2S)-2-amino-3-(1H-indol-3-yl)propanoate;hydrochloride |
| InChIKey | NLQCNZIZRSOJNB-YDALLXLXSA-N |
| SMILES | CC(C)OC(=O)[C@H](CC1=CNC2=CC=CC=C21)N.Cl |
Computed by PubChem (NCBI)