CAS 72028-74-1 appears in our catalog under these names: 2-Amino-2-(4-(benzyloxy)phenyl)acetic acid, 97%, Amino-(4-benzyloxy-phenyl)-acetic acid, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-amino-2-(4-phenylmethoxyphenyl)acetic acid (CAS 72028-74-1) is a chemical compound with the molecular formula C15H15NO3 and a molecular weight of 257.28 g/mol. IUPAC name: 2-amino-2-(4-phenylmethoxyphenyl)acetic acid. InChIKey: KTQBQIJCPWCCQL-UHFFFAOYSA-N.
| Molecular formula | C15H15NO3 |
|---|---|
| Molecular weight | 257.28 g/mol |
| IUPAC name | 2-amino-2-(4-phenylmethoxyphenyl)acetic acid |
| InChIKey | KTQBQIJCPWCCQL-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C(C(=O)O)N |
Computed by PubChem (NCBI)