Products 720675-90-1

CAS 720675-90-1 is the registry number for 6,2′,4′-Trimethoxyflavone. Offered by: MedChemExpress. Available pack sizes: 1 mg, 5 mg, 10 mg.

Structural formula: {0} (CAS {1})

2-(2,4-dimethoxyphenyl)-6-methoxychromen-4-one (CAS 720675-90-1) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: 2-(2,4-dimethoxyphenyl)-6-methoxychromen-4-one. InChIKey: WUWFDVDASNSUKP-UHFFFAOYSA-N.

Identity
Molecular formulaC18H16O5
Molecular weight312.3 g/mol
IUPAC name2-(2,4-dimethoxyphenyl)-6-methoxychromen-4-one
InChIKeyWUWFDVDASNSUKP-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)OC(=CC2=O)C3=C(C=C(C=C3)OC)OC

Computed by PubChem (NCBI)