Products 720675-93-4
CAS 720675-93-4 is the registry number for 3,6,3'-Trimethoxyflavone. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg, 250mg.
3,6-dimethoxy-2-(3-methoxyphenyl)chromen-4-one (CAS 720675-93-4) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: 3,6-dimethoxy-2-(3-methoxyphenyl)chromen-4-one. InChIKey: PRWZDYJHEPXPGA-UHFFFAOYSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 3,6-dimethoxy-2-(3-methoxyphenyl)chromen-4-one |
| InChIKey | PRWZDYJHEPXPGA-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)OC(=C(C2=O)OC)C3=CC(=CC=C3)OC |
Computed by PubChem (NCBI)