Products 720720-60-5
CAS 720720-60-5 appears in our catalog under these names: 4-(3-Oxomorpholino)benzoic acid, 95%, 4–(3–Oxomorpholino)benzoic acid. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 100mg, 1g, 5g.
4-(3-oxomorpholin-4-yl)benzoic acid (CAS 720720-60-5) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: 4-(3-oxomorpholin-4-yl)benzoic acid. InChIKey: HUZZDKHRFFOLQU-UHFFFAOYSA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | 4-(3-oxomorpholin-4-yl)benzoic acid |
| InChIKey | HUZZDKHRFFOLQU-UHFFFAOYSA-N |
| SMILES | C1COCC(=O)N1C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)