Products 721-26-6

CAS 721-26-6 is the registry number for 1,3-di-(2-hydroperoxy-2-propyl)benzene. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1,3-bis(2-hydroperoxypropan-2-yl)benzene (CAS 721-26-6) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: 1,3-bis(2-hydroperoxypropan-2-yl)benzene. InChIKey: IROSBXFYXRIPRU-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18O4
Molecular weight226.27 g/mol
IUPAC name1,3-bis(2-hydroperoxypropan-2-yl)benzene
InChIKeyIROSBXFYXRIPRU-UHFFFAOYSA-N
SMILESCC(C)(C1=CC(=CC=C1)C(C)(C)OO)OO

Computed by PubChem (NCBI)