CAS 721-26-6 is the registry number for 1,3-di-(2-hydroperoxy-2-propyl)benzene. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
1,3-bis(2-hydroperoxypropan-2-yl)benzene (CAS 721-26-6) is a chemical compound with the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. IUPAC name: 1,3-bis(2-hydroperoxypropan-2-yl)benzene. InChIKey: IROSBXFYXRIPRU-UHFFFAOYSA-N.
| Molecular formula | C12H18O4 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 1,3-bis(2-hydroperoxypropan-2-yl)benzene |
| InChIKey | IROSBXFYXRIPRU-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=CC=C1)C(C)(C)OO)OO |
Computed by PubChem (NCBI)