Products 721417-24-9
CAS 721417-24-9 appears in our catalog under these names: 3-(4-Acetyl-3,5-dimethyl-1h-pyrrol-2-yl)-3-oxopropanenitrile, 95%, 3-(4-Acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-3-oxopropanenitrile. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 2,5g.
3-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-3-oxopropanenitrile (CAS 721417-24-9) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 3-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-3-oxopropanenitrile. InChIKey: LPPFGQJSMHXOMT-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 3-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-3-oxopropanenitrile |
| InChIKey | LPPFGQJSMHXOMT-UHFFFAOYSA-N |
| SMILES | CC1=C(NC(=C1C(=O)C)C)C(=O)CC#N |
Computed by PubChem (NCBI)