CAS 7215-23-8 appears in our catalog under these names: 3,3–Diphenylazetidine, 3,3-Diphenylazetidine, 95%, 95%, 3,3-Diphenylazetidine, 95%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
3,3-diphenylazetidine (CAS 7215-23-8) is a chemical compound with the molecular formula C15H15N and a molecular weight of 209.29 g/mol. IUPAC name: 3,3-diphenylazetidine. InChIKey: IWLFFEFWBYZAAI-UHFFFAOYSA-N.
| Molecular formula | C15H15N |
|---|---|
| Molecular weight | 209.29 g/mol |
| IUPAC name | 3,3-diphenylazetidine |
| InChIKey | IWLFFEFWBYZAAI-UHFFFAOYSA-N |
| SMILES | C1C(CN1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)