CAS 7221-40-1 appears in our catalog under these names: N-Benzyl-2-hydroxy-N,N-dimethylethanaminium chloride 98%, Benzyl(2-hydroxyethyl)dimethylammonium chloride, 98%, 98%, BENZYL(2-HYDROXYETHYL)DIMETHYLAMMONIUM CHLORIDE, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 1g.
Benzyl-(2-hydroxyethyl)-dimethylazanium chloride (CAS 7221-40-1) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: benzyl-(2-hydroxyethyl)-dimethylazanium chloride. InChIKey: NUPDFKWZQURWCC-UHFFFAOYSA-M.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | benzyl-(2-hydroxyethyl)-dimethylazanium chloride |
| InChIKey | NUPDFKWZQURWCC-UHFFFAOYSA-M |
| SMILES | C[N+](C)(CCO)CC1=CC=CC=C1.[Cl-] |
Computed by PubChem (NCBI)