Products 7221-40-1

CAS 7221-40-1 appears in our catalog under these names: N-Benzyl-2-hydroxy-N,N-dimethylethanaminium chloride 98%, Benzyl(2-hydroxyethyl)dimethylammonium chloride, 98%, 98%, BENZYL(2-HYDROXYETHYL)DIMETHYLAMMONIUM CHLORIDE, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 100g, 1g.

Structural formula: {0} (CAS {1})

Benzyl-(2-hydroxyethyl)-dimethylazanium chloride (CAS 7221-40-1) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: benzyl-(2-hydroxyethyl)-dimethylazanium chloride. InChIKey: NUPDFKWZQURWCC-UHFFFAOYSA-M.

Identity
Molecular formulaC11H18ClNO
Molecular weight215.72 g/mol
IUPAC namebenzyl-(2-hydroxyethyl)-dimethylazanium chloride
InChIKeyNUPDFKWZQURWCC-UHFFFAOYSA-M
SMILESC[N+](C)(CCO)CC1=CC=CC=C1.[Cl-]

Computed by PubChem (NCBI)