CAS 723283-89-4 appears in our catalog under these names: 4–HYDROXY–5–BROMOQUINOLINE, 5-Bromoquinolin-4-ol, 95%, 5-Bromoquinolin-4-ol 95%, 5-Bromoquinolin-4-ol, 95%, 95%. Offered by: GLPBio, Combi-blocks, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 25g.
5-bromo-1H-quinolin-4-one (CAS 723283-89-4) is a chemical compound with the molecular formula C9H6BrNO and a molecular weight of 224.05 g/mol. IUPAC name: 5-bromo-1H-quinolin-4-one. InChIKey: LBHOUIRHKSQBFO-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO |
|---|---|
| Molecular weight | 224.05 g/mol |
| IUPAC name | 5-bromo-1H-quinolin-4-one |
| InChIKey | LBHOUIRHKSQBFO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=O)C=CN2)C(=C1)Br |
Computed by PubChem (NCBI)