Products 723294-94-8
CAS 723294-94-8 is the registry number for 2-[(5-Methylpyrazine-2-carbonyl)amino]-ethylaminehydrochloride. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
2-[(5-methylpyrazine-2-carbonyl)amino]ethylazanium chloride (CAS 723294-94-8) is a chemical compound with the molecular formula C8H13ClN4O and a molecular weight of 216.67 g/mol. IUPAC name: 2-[(5-methylpyrazine-2-carbonyl)amino]ethylazanium chloride. InChIKey: POLKNSYPCUHTTR-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN4O |
|---|---|
| Molecular weight | 216.67 g/mol |
| IUPAC name | 2-[(5-methylpyrazine-2-carbonyl)amino]ethylazanium chloride |
| InChIKey | POLKNSYPCUHTTR-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(C=N1)C(=O)NCC[NH3+].[Cl-] |
Computed by PubChem (NCBI)