Products 72398-31-3
CAS 72398-31-3 is the registry number for N1-Methyl-2’-deoxyinosine. Offered by: MedChemExpress. Available pack sizes: Get quote.
9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpurin-6-one (CAS 72398-31-3) is a chemical compound with the molecular formula C11H14N4O4 and a molecular weight of 266.25 g/mol. IUPAC name: 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpurin-6-one. InChIKey: OHRQAESFEIUOGS-XLPZGREQSA-N.
| Molecular formula | C11H14N4O4 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1-methylpurin-6-one |
| InChIKey | OHRQAESFEIUOGS-XLPZGREQSA-N |
| SMILES | CN1C=NC2=C(C1=O)N=CN2[C@H]3C[C@@H]([C@H](O3)CO)O |
Computed by PubChem (NCBI)
Synonyms:
N1-Methyl-2'-deoxyinosine, orb1907647