CAS 72496-00-5 is the registry number for (S)-(-)-Nicotine-15N. Offered by: TRC. Available pack sizes: 100mg.
3-[(2S)-1-methyl(115N)azolidin-2-yl]pyridine (CAS 72496-00-5) is a chemical compound with the molecular formula C10H14N2 and a molecular weight of 163.22 g/mol. IUPAC name: 3-[(2S)-1-methyl(115N)azolidin-2-yl]pyridine. InChIKey: SNICXCGAKADSCV-BKAHUFQTSA-N.
| Molecular formula | C10H14N2 |
|---|---|
| Molecular weight | 163.22 g/mol |
| IUPAC name | 3-[(2S)-1-methyl(115N)azolidin-2-yl]pyridine |
| InChIKey | SNICXCGAKADSCV-BKAHUFQTSA-N |
| SMILES | C[15N]1CCC[C@H]1C2=CN=CC=C2 |
Computed by PubChem (NCBI)