CAS 72518-42-4 is the registry number for 2-Phenylpiperidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-phenylpiperidine-2-carboxylic acid (CAS 72518-42-4) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 2-phenylpiperidine-2-carboxylic acid. InChIKey: ROLZGXIJZZQJSA-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 2-phenylpiperidine-2-carboxylic acid |
| InChIKey | ROLZGXIJZZQJSA-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)