Products 72748-87-9

CAS 72748-87-9 is the registry number for N-(4-(-Carboxycyclohexylmethyl))maleamidic Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 50mg.

Structural formula: {0} (CAS {1})

4-[(3-carboxyprop-2-enoylamino)methyl]cyclohexane-1-carboxylic acid (CAS 72748-87-9) is a chemical compound with the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. IUPAC name: 4-[(3-carboxyprop-2-enoylamino)methyl]cyclohexane-1-carboxylic acid. InChIKey: XFEDBGCHJRFAAA-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO5
Molecular weight255.27 g/mol
IUPAC name4-[(3-carboxyprop-2-enoylamino)methyl]cyclohexane-1-carboxylic acid
InChIKeyXFEDBGCHJRFAAA-UHFFFAOYSA-N
SMILESC1CC(CCC1CNC(=O)C=CC(=O)O)C(=O)O

Computed by PubChem (NCBI)