CAS 727674-98-8 appears in our catalog under these names: 6-Bromo-1,3-dimethylquinazoline-2,4(1h,3h)-dione, 96%, 6-Bromo-1,3-dimethylquinazoline-2,4(1H,3H)-dione, 97%, 6–Bromo–1,3–dimethylquinazoline–2,4(1h,3h)–dione. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 10g, 5g, 1g.
6-bromo-1,3-dimethylquinazoline-2,4-dione (CAS 727674-98-8) is a chemical compound with the molecular formula C10H9BrN2O2 and a molecular weight of 269.09 g/mol. IUPAC name: 6-bromo-1,3-dimethylquinazoline-2,4-dione. InChIKey: FGSNYLHKLUUNQB-UHFFFAOYSA-N.
| Molecular formula | C10H9BrN2O2 |
|---|---|
| Molecular weight | 269.09 g/mol |
| IUPAC name | 6-bromo-1,3-dimethylquinazoline-2,4-dione |
| InChIKey | FGSNYLHKLUUNQB-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C=C2)Br)C(=O)N(C1=O)C |
Computed by PubChem (NCBI)