CAS 7291-00-1 is the registry number for N,N-Dimethyl-4-methoxybenzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g.
4-methoxy-N,N-dimethylbenzamide (CAS 7291-00-1) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 4-methoxy-N,N-dimethylbenzamide. InChIKey: OCGXPFSUJVHRHA-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | 4-methoxy-N,N-dimethylbenzamide |
| InChIKey | OCGXPFSUJVHRHA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC=C(C=C1)OC |
Computed by PubChem (NCBI)