Products 73058-37-4
CAS 73058-37-4 appears in our catalog under these names: 4-(8,9-Dihydropyrido(2,3-b)-1,6-naphthyridin-7(6H)-yl)-4-oxobutanoic acid, 95%, Bortezomib Impurity F, N-Pyrazinylcarbonyl-L-phenylalanine Methyl Ester, >95% (HPLC), N-Pyrazinylcarbonyl-L-phenylalanine methyl ester, N-Pyrazinylcarbonyl-L-phenylalanine Methyl Ester, 95%, 95%. Offered by: AmBeed, Chemat Brand, TRC, Biosynth, Chemat. Available pack sizes: 250mg, on request, 100mg, 1g.
Methyl 3-phenyl-2-(pyrazine-2-carbonylamino)propanoate (CAS 73058-37-4) is a chemical compound with the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. IUPAC name: methyl 3-phenyl-2-(pyrazine-2-carbonylamino)propanoate. InChIKey: AGZXSMPTQAISJW-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O3 |
|---|---|
| Molecular weight | 285.30 g/mol |
| IUPAC name | methyl 3-phenyl-2-(pyrazine-2-carbonylamino)propanoate |
| InChIKey | AGZXSMPTQAISJW-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CC1=CC=CC=C1)NC(=O)C2=NC=CN=C2 |
Computed by PubChem (NCBI)