Products 73080-75-8
CAS 73080-75-8 is the registry number for Ethyl 5,6-Dihydro-7,8-dimethyl-4,5-dioxo-4H-pyrano(3,2-c)quinoline-2-carboxylic Acid Ester. Offered by: TRC. Available pack sizes: 250mg.
Ethyl 7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylate (CAS 73080-75-8) is a chemical compound with the molecular formula C17H15NO5 and a molecular weight of 313.30 g/mol. IUPAC name: ethyl 7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylate. InChIKey: OBIXUTKFTBMVJT-UHFFFAOYSA-N.
| Molecular formula | C17H15NO5 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | ethyl 7,8-dimethyl-4,5-dioxo-6H-pyrano[3,2-c]quinoline-2-carboxylate |
| InChIKey | OBIXUTKFTBMVJT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=O)C2=C(O1)C3=C(C(=C(C=C3)C)C)NC2=O |
Computed by PubChem (NCBI)