CAS 923854-18-6 is the registry number for 3-(2,3-Dihydro-1,4-benzodioxine-6-amido)-4-methylbenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)-4-methylbenzoic acid (CAS 923854-18-6) is a chemical compound with the molecular formula C17H15NO5 and a molecular weight of 313.30 g/mol. IUPAC name: 3-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)-4-methylbenzoic acid. InChIKey: VLBSXTHFBRVWJR-UHFFFAOYSA-N.
| Molecular formula | C17H15NO5 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | 3-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)-4-methylbenzoic acid |
| InChIKey | VLBSXTHFBRVWJR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)NC(=O)C2=CC3=C(C=C2)OCCO3 |
Computed by PubChem (NCBI)