CAS 1618-52-6 is the registry number for 2-(1-Carboxy-N-(2,3-dimethylphenyl)formamido)benzoic acid, 97%. Offered by: AmBeed. Available pack sizes: 250mg.
2-(2,3-dimethyl-N-oxaloanilino)benzoic acid (CAS 1618-52-6) is a chemical compound with the molecular formula C17H15NO5 and a molecular weight of 313.30 g/mol. IUPAC name: 2-(2,3-dimethyl-N-oxaloanilino)benzoic acid. InChIKey: LTLAECLFZXWEMD-UHFFFAOYSA-N.
| Molecular formula | C17H15NO5 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | 2-(2,3-dimethyl-N-oxaloanilino)benzoic acid |
| InChIKey | LTLAECLFZXWEMD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N(C2=CC=CC=C2C(=O)O)C(=O)C(=O)O)C |
Computed by PubChem (NCBI)