CAS 87549-36-8 appears in our catalog under these names: Parcetasal, Parcetasal/ 99.32% (existing batch purity), Parcetasal (MR–897), Parcetasal, 99.88%, Parcetasal, 99%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 500mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
N-[4-[(2-methyl-4-oxo-1,3-benzodioxin-2-yl)oxy]phenyl]acetamide (CAS 87549-36-8) is a chemical compound with the molecular formula C17H15NO5 and a molecular weight of 313.30 g/mol. IUPAC name: N-[4-[(2-methyl-4-oxo-1,3-benzodioxin-2-yl)oxy]phenyl]acetamide. InChIKey: ZAPRLADYRFPQSH-UHFFFAOYSA-N.
| Molecular formula | C17H15NO5 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | N-[4-[(2-methyl-4-oxo-1,3-benzodioxin-2-yl)oxy]phenyl]acetamide |
| InChIKey | ZAPRLADYRFPQSH-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)OC2(OC3=CC=CC=C3C(=O)O2)C |
Computed by PubChem (NCBI)