Products 123106-21-8
CAS 123106-21-8 appears in our catalog under these names: Fmoc-aoac-oh, 97%, Fmoc-AOAc-OH, Fmoc-Aoa-OH 97%, Fmoc-Aoa-OH, 97%, 97%, Fmoc-Aoa, 98%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 25g, 1g, 100mg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)oxyacetic acid (CAS 123106-21-8) is a chemical compound with the molecular formula C17H15NO5 and a molecular weight of 313.30 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)oxyacetic acid. InChIKey: XQLJEKGEUGUEJZ-UHFFFAOYSA-N.
| Molecular formula | C17H15NO5 |
|---|---|
| Molecular weight | 313.30 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)oxyacetic acid |
| InChIKey | XQLJEKGEUGUEJZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NOCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Fmoc-Aoa-OH, Fmoc-AOAc-OH, fmoc-aminoxyacetic acid, Fmoc-Aoa, Fmoc-3-(aminooxy)acetic acid, 2-[(Fmoc-amino)oxy]acetic acid, 2-(9H-fluoren-9-ylmethoxycarbonylamino)oxyacetic acid, 2-(((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)oxy)acetic acid, FMOC-AMINOXYACETICACID, 2-[Fmoc(amino)oxy]acetic Acid