Products 73108-24-4
CAS 73108-24-4 is the registry number for 1,2,3,4-Tetra-O-acetyl-6-azido-6-deoxy-α-D-galactopyranose. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 25mg, 50mg.
[(2R,3S,4S,5R,6R)-4,5,6-triacetyloxy-2-(azidomethyl)oxan-3-yl] acetate (CAS 73108-24-4) is a chemical compound with the molecular formula C14H19N3O9 and a molecular weight of 373.32 g/mol. IUPAC name: [(2R,3S,4S,5R,6R)-4,5,6-triacetyloxy-2-(azidomethyl)oxan-3-yl] acetate. InChIKey: LFQWTDKRDROWBN-HTOAHKCRSA-N.
| Molecular formula | C14H19N3O9 |
|---|---|
| Molecular weight | 373.32 g/mol |
| IUPAC name | [(2R,3S,4S,5R,6R)-4,5,6-triacetyloxy-2-(azidomethyl)oxan-3-yl] acetate |
| InChIKey | LFQWTDKRDROWBN-HTOAHKCRSA-N |
| SMILES | CC(=O)O[C@H]1[C@H](O[C@@H]([C@@H]([C@H]1OC(=O)C)OC(=O)C)OC(=O)C)CN=[N+]=[N-] |
Computed by PubChem (NCBI)