Products 731785-24-3
CAS 731785-24-3 is the registry number for 1-[4-(3-Bromoprop-1-yn-1-yl)phenyl]ethan-1-one, 95%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-[4-(3-bromoprop-1-ynyl)phenyl]ethanone (CAS 731785-24-3) is a chemical compound with the molecular formula C11H9BrO and a molecular weight of 237.09 g/mol. IUPAC name: 1-[4-(3-bromoprop-1-ynyl)phenyl]ethanone. InChIKey: RQIWRLPDJMDQFS-UHFFFAOYSA-N.
| Molecular formula | C11H9BrO |
|---|---|
| Molecular weight | 237.09 g/mol |
| IUPAC name | 1-[4-(3-bromoprop-1-ynyl)phenyl]ethanone |
| InChIKey | RQIWRLPDJMDQFS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C#CCBr |
Computed by PubChem (NCBI)