Products 731826-33-8
CAS 731826-33-8 is the registry number for Azepan-1-yl(6-chloropyridin-3-yl)methanone, 98%. Offered by: Chemat. Available pack sizes: 100mg.
Azepan-1-yl-(6-chloro-3-pyridinyl)methanone (CAS 731826-33-8) is a chemical compound with the molecular formula C12H15ClN2O and a molecular weight of 238.71 g/mol. IUPAC name: azepan-1-yl-(6-chloro-3-pyridinyl)methanone. InChIKey: XRUSOMUVFCDBRN-UHFFFAOYSA-N.
| Molecular formula | C12H15ClN2O |
|---|---|
| Molecular weight | 238.71 g/mol |
| IUPAC name | azepan-1-yl-(6-chloro-3-pyridinyl)methanone |
| InChIKey | XRUSOMUVFCDBRN-UHFFFAOYSA-N |
| SMILES | C1CCCN(CC1)C(=O)C2=CN=C(C=C2)Cl |
Computed by PubChem (NCBI)