CAS 731859-03-3 appears in our catalog under these names: (1R)-7-Methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 95%, (1R)-7-Methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, (1R)-7-methyl-1,2,3,4-tetrahydronaphthalen-1-amine hydrochloride, 98%, 98%, (1R)-7-METHYL-1,2,3,4-TETRAHYDRONAPHTHYLAMINE HCL, 95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 0,5g, 50mg, 100mg, 250mg.
(1R)-7-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride (CAS 731859-03-3) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (1R)-7-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride. InChIKey: HCBRYFDVZWVSGL-RFVHGSKJSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (1R)-7-methyl-1,2,3,4-tetrahydronaphthalen-1-amine;hydrochloride |
| InChIKey | HCBRYFDVZWVSGL-RFVHGSKJSA-N |
| SMILES | CC1=CC2=C(CCC[C@H]2N)C=C1.Cl |
Computed by PubChem (NCBI)