Products 732308-80-4
CAS 732308-80-4 appears in our catalog under these names: 1-(4-Bromophenyl)cyclohexanecarboxylic acid, 1-(4-Bromophenyl)Cyclohexanecarboxylic Acid, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g.
1-(4-bromophenyl)cyclohexane-1-carboxylic acid (CAS 732308-80-4) is a chemical compound with the molecular formula C13H15BrO2 and a molecular weight of 283.16 g/mol. IUPAC name: 1-(4-bromophenyl)cyclohexane-1-carboxylic acid. InChIKey: JJVXUXDLDJORKK-UHFFFAOYSA-N.
| Molecular formula | C13H15BrO2 |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | 1-(4-bromophenyl)cyclohexane-1-carboxylic acid |
| InChIKey | JJVXUXDLDJORKK-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=CC=C(C=C2)Br)C(=O)O |
Computed by PubChem (NCBI)