CAS 73318-75-9 appears in our catalog under these names: 6-Methoxy-5-nitropyrimidin-4-amine, 97%, 6-Methoxy-5-nitropyrimidin-4-amine 95%, 6-Methoxy-5-nitropyrimidin-4-amine, 97%, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
6-methoxy-5-nitropyrimidin-4-amine (CAS 73318-75-9) is a chemical compound with the molecular formula C5H6N4O3 and a molecular weight of 170.13 g/mol. IUPAC name: 6-methoxy-5-nitropyrimidin-4-amine. InChIKey: WOWLLOQOVOHVSH-UHFFFAOYSA-N.
| Molecular formula | C5H6N4O3 |
|---|---|
| Molecular weight | 170.13 g/mol |
| IUPAC name | 6-methoxy-5-nitropyrimidin-4-amine |
| InChIKey | WOWLLOQOVOHVSH-UHFFFAOYSA-N |
| SMILES | COC1=NC=NC(=C1[N+](=O)[O-])N |
Computed by PubChem (NCBI)