Products 7335-32-2
CAS 7335-32-2 appears in our catalog under these names: Ethyl 5-amino-2-methylbenzoate 98%, Ethyl 5-amino-2-methylbenzoate, 98%, Ethyl 5-amino-2-methylbenzoate, 98%, 98%. Offered by: Ambeed, Fluorochem, Chemat. Available pack sizes: 5g, 25g, 100g.
Ethyl 5-amino-2-methylbenzoate (CAS 7335-32-2) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: ethyl 5-amino-2-methylbenzoate. InChIKey: TYJRZPFHAFUADO-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | ethyl 5-amino-2-methylbenzoate |
| InChIKey | TYJRZPFHAFUADO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)N)C |
Computed by PubChem (NCBI)