Products 73426-77-4
CAS 73426-77-4 is the registry number for (S)-2-Amino-N-(4-isopropylphenyl)-3-methylbutanamide hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-amino-3-methyl-N-(4-propan-2-ylphenyl)butanamide;hydrochloride (CAS 73426-77-4) is a chemical compound with the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. IUPAC name: (2S)-2-amino-3-methyl-N-(4-propan-2-ylphenyl)butanamide;hydrochloride. InChIKey: JRWNQLROXYOBJU-ZOWNYOTGSA-N.
| Molecular formula | C14H23ClN2O |
|---|---|
| Molecular weight | 270.80 g/mol |
| IUPAC name | (2S)-2-amino-3-methyl-N-(4-propan-2-ylphenyl)butanamide;hydrochloride |
| InChIKey | JRWNQLROXYOBJU-ZOWNYOTGSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)NC(=O)[C@H](C(C)C)N.Cl |
Computed by PubChem (NCBI)