Products 73428-00-9
CAS 73428-00-9 is the registry number for 4-Ethyl-7,8-dihydro-1H-pyrano[3,4-f]indolizine-3,6,10(4H)-trione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-ethyl-1,4,7,8-tetrahydropyrano[3,4-f]indolizine-3,6,10-trione (CAS 73428-00-9) is a chemical compound with the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. IUPAC name: 4-ethyl-1,4,7,8-tetrahydropyrano[3,4-f]indolizine-3,6,10-trione. InChIKey: PUGYUNLZHPTCON-UHFFFAOYSA-N.
| Molecular formula | C13H13NO4 |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 4-ethyl-1,4,7,8-tetrahydropyrano[3,4-f]indolizine-3,6,10-trione |
| InChIKey | PUGYUNLZHPTCON-UHFFFAOYSA-N |
| SMILES | CCC1C2=C(COC1=O)C(=O)N3CCC(=O)C3=C2 |
Computed by PubChem (NCBI)