Products 734532-12-8

CAS 734532-12-8 is the registry number for 1,3-Dihydrospiro[indene-2,3'-pyrrolidine]-5'-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Spiro[1,3-dihydroindene-2,4'-pyrrolidine]-2'-carboxylic acid (CAS 734532-12-8) is a chemical compound with the molecular formula C13H15NO2 and a molecular weight of 217.26 g/mol. IUPAC name: spiro[1,3-dihydroindene-2,4'-pyrrolidine]-2'-carboxylic acid. InChIKey: TULSNRXSLZPXFV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15NO2
Molecular weight217.26 g/mol
IUPAC namespiro[1,3-dihydroindene-2,4'-pyrrolidine]-2'-carboxylic acid
InChIKeyTULSNRXSLZPXFV-UHFFFAOYSA-N
SMILESC1C(NCC12CC3=CC=CC=C3C2)C(=O)O

Computed by PubChem (NCBI)