CAS 73471-96-2 is the registry number for 1-(4-Ethylphenyl)-2,2,2-trifluoroethanone, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-(4-ethylphenyl)-2,2,2-trifluoroethanone (CAS 73471-96-2) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: 1-(4-ethylphenyl)-2,2,2-trifluoroethanone. InChIKey: ISFVKKPXBGQFRW-UHFFFAOYSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | 1-(4-ethylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | ISFVKKPXBGQFRW-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)