Products 73488-65-0
CAS 73488-65-0 appears in our catalog under these names: L–Methionine–13C,d3, L-Methionine-methyl-13C,methyl-D3, L-Methionine-13C,d3, 99.9%, L-methionine-(methyl-13C,D3), >=99 atom. Offered by: GLPBio, Biosynth, MedChemExpress, Sigma-Aldrich. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 0,25g, 50 mg, 100 mg.
(2S)-2-amino-4-(trideuterio(113C)methylsulfanyl)butanoic acid (CAS 73488-65-0) is a chemical compound with the molecular formula C5H11NO2S and a molecular weight of 153.23 g/mol. IUPAC name: (2S)-2-amino-4-(trideuterio(113C)methylsulfanyl)butanoic acid. InChIKey: FFEARJCKVFRZRR-ZIHWZSJBSA-N.
| Molecular formula | C5H11NO2S |
|---|---|
| Molecular weight | 153.23 g/mol |
| IUPAC name | (2S)-2-amino-4-(trideuterio(113C)methylsulfanyl)butanoic acid |
| InChIKey | FFEARJCKVFRZRR-ZIHWZSJBSA-N |
| SMILES | [2H][13C]([2H])([2H])SCC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)