Products 73686-77-8

CAS 73686-77-8 is the registry number for 4-(Propylamino)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

4-(propylamino)benzoic acid (CAS 73686-77-8) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: 4-(propylamino)benzoic acid. InChIKey: BFPWLARXKLUGHY-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO2
Molecular weight179.22 g/mol
IUPAC name4-(propylamino)benzoic acid
InChIKeyBFPWLARXKLUGHY-UHFFFAOYSA-N
SMILESCCCNC1=CC=C(C=C1)C(=O)O

Computed by PubChem (NCBI)