CAS 737000-78-1 is the registry number for 2-(Boc-amino)-4-cyanopyridine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Tert-butyl N-(4-cyano-2-pyridinyl)carbamate (CAS 737000-78-1) is a chemical compound with the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. IUPAC name: tert-butyl N-(4-cyano-2-pyridinyl)carbamate. InChIKey: YDQSFIWCKUKWEG-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O2 |
|---|---|
| Molecular weight | 219.24 g/mol |
| IUPAC name | tert-butyl N-(4-cyano-2-pyridinyl)carbamate |
| InChIKey | YDQSFIWCKUKWEG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=NC=CC(=C1)C#N |
Computed by PubChem (NCBI)