CAS 7372-87-4 is the registry number for 1,8-Dimethylphenanthrene. Offered by: TRC. Available pack sizes: 25mg.
1,8-dimethylphenanthrene (CAS 7372-87-4) is a chemical compound with the molecular formula C16H14 and a molecular weight of 206.28 g/mol. IUPAC name: 1,8-dimethylphenanthrene. InChIKey: LPHQUKCANLSJRU-UHFFFAOYSA-N.
| Molecular formula | C16H14 |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | 1,8-dimethylphenanthrene |
| InChIKey | LPHQUKCANLSJRU-UHFFFAOYSA-N |
| SMILES | CC1=C2C=CC3=C(C=CC=C3C2=CC=C1)C |
Computed by PubChem (NCBI)