Products 73738-06-4
CAS 73738-06-4 appears in our catalog under these names: Primidone-d5, Primidone-d5, >95% (HPLC), Primidone-d5 (ethyl-d5), 99 atom % D, min 98% Chemical Purity, Primidone-d5, 99.00%. Offered by: Chemat Brand, TRC, CDN, TargetMol, MedChemExpress. Available pack sizes: on request, 10mg, 1mg, 5mg, 0,01g, 0,005g, 1 mg, 5 mg.
5-(1,1,2,2,2-pentadeuterioethyl)-5-phenyl-1,3-diazinane-4,6-dione (CAS 73738-06-4) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 223.28 g/mol. IUPAC name: 5-(1,1,2,2,2-pentadeuterioethyl)-5-phenyl-1,3-diazinane-4,6-dione. InChIKey: DQMZLTXERSFNPB-ZBJDZAJPSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 223.28 g/mol |
| IUPAC name | 5-(1,1,2,2,2-pentadeuterioethyl)-5-phenyl-1,3-diazinane-4,6-dione |
| InChIKey | DQMZLTXERSFNPB-ZBJDZAJPSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C1(C(=O)NCNC1=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)