Products 73777-65-8
CAS 73777-65-8 is the registry number for Renierone. Offered by: MedChemExpress. Available pack sizes: Get quote.
(7-methoxy-6-methyl-5,8-dioxoisoquinolin-1-yl)methyl (Z)-2-methylbut-2-enoate (CAS 73777-65-8) is a chemical compound with the molecular formula C17H17NO5 and a molecular weight of 315.32 g/mol. IUPAC name: (7-methoxy-6-methyl-5,8-dioxoisoquinolin-1-yl)methyl (Z)-2-methylbut-2-enoate. InChIKey: JGSPEFLRDJUZIE-UITAMQMPSA-N.
| Molecular formula | C17H17NO5 |
|---|---|
| Molecular weight | 315.32 g/mol |
| IUPAC name | (7-methoxy-6-methyl-5,8-dioxoisoquinolin-1-yl)methyl (Z)-2-methylbut-2-enoate |
| InChIKey | JGSPEFLRDJUZIE-UITAMQMPSA-N |
| SMILES | C/C=C(/C)\C(=O)OCC1=NC=CC2=C1C(=O)C(=C(C2=O)C)OC |
Computed by PubChem (NCBI)